CAS 1893498-83-3 is the registry number for 2,2-Dibromo-1-(3-chloro-4-fluorophenyl)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2-dibromo-1-(3-chloro-4-fluorophenyl)ethanone (CAS 1893498-83-3) is a chemical compound with the molecular formula C8H4Br2ClFO and a molecular weight of 330.37 g/mol. IUPAC name: 2,2-dibromo-1-(3-chloro-4-fluorophenyl)ethanone. InChIKey: IRLUNFDCIHQKEN-UHFFFAOYSA-N.
| Molecular formula | C8H4Br2ClFO |
|---|---|
| Molecular weight | 330.37 g/mol |
| IUPAC name | 2,2-dibromo-1-(3-chloro-4-fluorophenyl)ethanone |
| InChIKey | IRLUNFDCIHQKEN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)C(Br)Br)Cl)F |
Computed by PubChem (NCBI)