Products 1804873-52-6
CAS 1804873-52-6 is the registry number for Methyl 2-amino-5-fluoro-4-(trifluoromethoxy)benzoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 2-amino-5-fluoro-4-(trifluoromethoxy)benzoate (CAS 1804873-52-6) is a chemical compound with the molecular formula C9H7F4NO3 and a molecular weight of 253.15 g/mol. IUPAC name: methyl 2-amino-5-fluoro-4-(trifluoromethoxy)benzoate. InChIKey: NEMXDXONNAFICR-UHFFFAOYSA-N.
| Molecular formula | C9H7F4NO3 |
|---|---|
| Molecular weight | 253.15 g/mol |
| IUPAC name | methyl 2-amino-5-fluoro-4-(trifluoromethoxy)benzoate |
| InChIKey | NEMXDXONNAFICR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1N)OC(F)(F)F)F |
Computed by PubChem (NCBI)