Products 1805454-46-9
CAS 1805454-46-9 is the registry number for Methyl 2-chloro-3-fluoro-5-methylbenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
Methyl 2-chloro-3-fluoro-5-methylbenzoate (CAS 1805454-46-9) is a chemical compound with the molecular formula C9H8ClFO2 and a molecular weight of 202.61 g/mol. IUPAC name: methyl 2-chloro-3-fluoro-5-methylbenzoate. InChIKey: NBZOAYYGISZOPF-UHFFFAOYSA-N.
| Molecular formula | C9H8ClFO2 |
|---|---|
| Molecular weight | 202.61 g/mol |
| IUPAC name | methyl 2-chloro-3-fluoro-5-methylbenzoate |
| InChIKey | NBZOAYYGISZOPF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)F)Cl)C(=O)OC |
Computed by PubChem (NCBI)