Products 1805591-15-4
CAS 1805591-15-4 is the registry number for Methyl 5-bromo-2-cyano-4-fluorobenzoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 5-bromo-2-cyano-4-fluorobenzoate (CAS 1805591-15-4) is a chemical compound with the molecular formula C9H5BrFNO2 and a molecular weight of 258.04 g/mol. IUPAC name: methyl 5-bromo-2-cyano-4-fluorobenzoate. InChIKey: FTYHKEBIFWRJAL-UHFFFAOYSA-N.
| Molecular formula | C9H5BrFNO2 |
|---|---|
| Molecular weight | 258.04 g/mol |
| IUPAC name | methyl 5-bromo-2-cyano-4-fluorobenzoate |
| InChIKey | FTYHKEBIFWRJAL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1C#N)F)Br |
Computed by PubChem (NCBI)