Products 1805594-40-4

CAS 1805594-40-4 is the registry number for Methyl 3-bromo-2,5-dimethylbenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 3-bromo-2,5-dimethylbenzoate (CAS 1805594-40-4) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: methyl 3-bromo-2,5-dimethylbenzoate. InChIKey: OYRPIHJCEFWWOD-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11BrO2
Molecular weight243.10 g/mol
IUPAC namemethyl 3-bromo-2,5-dimethylbenzoate
InChIKeyOYRPIHJCEFWWOD-UHFFFAOYSA-N
SMILESCC1=CC(=C(C(=C1)Br)C)C(=O)OC

Computed by PubChem (NCBI)