Products 1805790-46-8
CAS 1805790-46-8 is the registry number for tert-Butyl (3R,4R)-4-(hydroxymethyl)-3-(methoxymethoxy)piperidine-1-carboxylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (3R,4R)-4-(hydroxymethyl)-3-(methoxymethoxy)piperidine-1-carboxylate (CAS 1805790-46-8) is a chemical compound with the molecular formula C13H25NO5 and a molecular weight of 275.34 g/mol. IUPAC name: tert-butyl (3R,4R)-4-(hydroxymethyl)-3-(methoxymethoxy)piperidine-1-carboxylate. InChIKey: JGNBOQGZESBKFH-MNOVXSKESA-N.
| Molecular formula | C13H25NO5 |
|---|---|
| Molecular weight | 275.34 g/mol |
| IUPAC name | tert-butyl (3R,4R)-4-(hydroxymethyl)-3-(methoxymethoxy)piperidine-1-carboxylate |
| InChIKey | JGNBOQGZESBKFH-MNOVXSKESA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]([C@H](C1)OCOC)CO |
Computed by PubChem (NCBI)