CAS 1806329-22-5 is the registry number for 3,4-Dichloro-2,5-difluoroaniline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3,4-dichloro-2,5-difluoroaniline (CAS 1806329-22-5) is a chemical compound with the molecular formula C6H3Cl2F2N and a molecular weight of 197.99 g/mol. IUPAC name: 3,4-dichloro-2,5-difluoroaniline. InChIKey: BZNUORCPJLNKNH-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2F2N |
|---|---|
| Molecular weight | 197.99 g/mol |
| IUPAC name | 3,4-dichloro-2,5-difluoroaniline |
| InChIKey | BZNUORCPJLNKNH-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)Cl)Cl)F)N |
Computed by PubChem (NCBI)