Products 1806451-09-1
CAS 1806451-09-1 is the registry number for 2,5-Dimethyl-3-(trifluoromethyl)phenol, 97%. Offered by: Ambeed, BLDpharm. Available pack sizes: 100mg, 250mg, 1g.
2,5-dimethyl-3-(trifluoromethyl)phenol (CAS 1806451-09-1) is a chemical compound with the molecular formula C9H9F3O and a molecular weight of 190.16 g/mol. IUPAC name: 2,5-dimethyl-3-(trifluoromethyl)phenol. InChIKey: MCNSITYPIPQHTN-UHFFFAOYSA-N.
| Molecular formula | C9H9F3O |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 2,5-dimethyl-3-(trifluoromethyl)phenol |
| InChIKey | MCNSITYPIPQHTN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)O)C)C(F)(F)F |
Computed by PubChem (NCBI)