CAS 1806521-85-6 is the registry number for 2-Sulfanyl-1,3-benzoxazole-6-carbonitrile. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-sulfanylidene-3H-1,3-benzoxazole-6-carbonitrile (CAS 1806521-85-6) is a chemical compound with the molecular formula C8H4N2OS and a molecular weight of 176.20 g/mol. IUPAC name: 2-sulfanylidene-3H-1,3-benzoxazole-6-carbonitrile. InChIKey: MCBHOPRXVFGNKV-UHFFFAOYSA-N.
| Molecular formula | C8H4N2OS |
|---|---|
| Molecular weight | 176.20 g/mol |
| IUPAC name | 2-sulfanylidene-3H-1,3-benzoxazole-6-carbonitrile |
| InChIKey | MCBHOPRXVFGNKV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C#N)OC(=S)N2 |
Computed by PubChem (NCBI)