CAS 1823914-75-5 is the registry number for 2-Isothiocyanatobenzo[d]oxazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-isothiocyanato-1,3-benzoxazole (CAS 1823914-75-5) is a chemical compound with the molecular formula C8H4N2OS and a molecular weight of 176.20 g/mol. IUPAC name: 2-isothiocyanato-1,3-benzoxazole. InChIKey: UNZKUUJWWXVDCI-UHFFFAOYSA-N.
| Molecular formula | C8H4N2OS |
|---|---|
| Molecular weight | 176.20 g/mol |
| IUPAC name | 2-isothiocyanato-1,3-benzoxazole |
| InChIKey | UNZKUUJWWXVDCI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(O2)N=C=S |
Computed by PubChem (NCBI)