CAS 7267-38-1 is the registry number for 5–Hydroxybenzo(d)thiazole–2–carbonitrile. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
5-hydroxy-1,3-benzothiazole-2-carbonitrile (CAS 7267-38-1) is a chemical compound with the molecular formula C8H4N2OS and a molecular weight of 176.20 g/mol. IUPAC name: 5-hydroxy-1,3-benzothiazole-2-carbonitrile. InChIKey: DTXINWSDUBHXMK-UHFFFAOYSA-N.
| Molecular formula | C8H4N2OS |
|---|---|
| Molecular weight | 176.20 g/mol |
| IUPAC name | 5-hydroxy-1,3-benzothiazole-2-carbonitrile |
| InChIKey | DTXINWSDUBHXMK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)N=C(S2)C#N |
Computed by PubChem (NCBI)