CAS 93794-41-3 is the registry number for 2-Thioxo-2,3-dihydro-1,3-benzoxazole-5-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g.
2-sulfanylidene-3H-1,3-benzoxazole-5-carbonitrile (CAS 93794-41-3) is a chemical compound with the molecular formula C8H4N2OS and a molecular weight of 176.20 g/mol. IUPAC name: 2-sulfanylidene-3H-1,3-benzoxazole-5-carbonitrile. InChIKey: WFWNMCPXXCRAMH-UHFFFAOYSA-N.
| Molecular formula | C8H4N2OS |
|---|---|
| Molecular weight | 176.20 g/mol |
| IUPAC name | 2-sulfanylidene-3H-1,3-benzoxazole-5-carbonitrile |
| InChIKey | WFWNMCPXXCRAMH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C#N)NC(=S)O2 |
Computed by PubChem (NCBI)