CAS 1807069-94-8 is the registry number for 2-Bromo-6-fluoro-3-(trifluoromethyl)pyridine, 97%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
2-bromo-6-fluoro-3-(trifluoromethyl)pyridine (CAS 1807069-94-8) is a chemical compound with the molecular formula C6H2BrF4N and a molecular weight of 243.98 g/mol. IUPAC name: 2-bromo-6-fluoro-3-(trifluoromethyl)pyridine. InChIKey: XKYDUAQRESIJGB-UHFFFAOYSA-N.
| Molecular formula | C6H2BrF4N |
|---|---|
| Molecular weight | 243.98 g/mol |
| IUPAC name | 2-bromo-6-fluoro-3-(trifluoromethyl)pyridine |
| InChIKey | XKYDUAQRESIJGB-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1C(F)(F)F)Br)F |
Computed by PubChem (NCBI)