Products 1807071-16-4
CAS 1807071-16-4 is the registry number for 3-Bromo-2,5-difluorobenzotrifluoride. Offered by: Biosynth. Available pack sizes: 2000mg.
1-bromo-2,5-difluoro-3-(trifluoromethyl)benzene (CAS 1807071-16-4) is a chemical compound with the molecular formula C7H2BrF5 and a molecular weight of 260.99 g/mol. IUPAC name: 1-bromo-2,5-difluoro-3-(trifluoromethyl)benzene. InChIKey: NZBVTMOHTWCRNG-UHFFFAOYSA-N.
| Molecular formula | C7H2BrF5 |
|---|---|
| Molecular weight | 260.99 g/mol |
| IUPAC name | 1-bromo-2,5-difluoro-3-(trifluoromethyl)benzene |
| InChIKey | NZBVTMOHTWCRNG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)F)Br)F |
Computed by PubChem (NCBI)