CAS 1807183-78-3 appears in our catalog under these names: 3,4-Dichloro-2,6-difluoroaniline 97%, 3,4-Dichloro-2,6-difluoroaniline, 97%, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
3,4-dichloro-2,6-difluoroaniline (CAS 1807183-78-3) is a chemical compound with the molecular formula C6H3Cl2F2N and a molecular weight of 197.99 g/mol. IUPAC name: 3,4-dichloro-2,6-difluoroaniline. InChIKey: MDZAIFSIVZUSNP-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2F2N |
|---|---|
| Molecular weight | 197.99 g/mol |
| IUPAC name | 3,4-dichloro-2,6-difluoroaniline |
| InChIKey | MDZAIFSIVZUSNP-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Cl)Cl)F)N)F |
Computed by PubChem (NCBI)