Products 1807223-02-4
CAS 1807223-02-4 is the registry number for ethyl 2-[4-amino-5-(trifluoromethyl)-2-pyridyl]acetate, 97%. Offered by: Chemat. Available pack sizes: 1g.
Ethyl 2-[4-amino-5-(trifluoromethyl)-2-pyridinyl]acetate (CAS 1807223-02-4) is a chemical compound with the molecular formula C10H11F3N2O2 and a molecular weight of 248.20 g/mol. IUPAC name: ethyl 2-[4-amino-5-(trifluoromethyl)-2-pyridinyl]acetate. InChIKey: BIYYOKPMGNMMDG-UHFFFAOYSA-N.
| Molecular formula | C10H11F3N2O2 |
|---|---|
| Molecular weight | 248.20 g/mol |
| IUPAC name | ethyl 2-[4-amino-5-(trifluoromethyl)-2-pyridinyl]acetate |
| InChIKey | BIYYOKPMGNMMDG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=CC(=C(C=N1)C(F)(F)F)N |
Computed by PubChem (NCBI)