CAS 1807633-44-8 is the registry number for Dimethyl (2R,3R)-piperidine-2,3-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Dimethyl (2R,3R)-piperidine-2,3-dicarboxylate (CAS 1807633-44-8) is a chemical compound with the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. IUPAC name: dimethyl (2R,3R)-piperidine-2,3-dicarboxylate. InChIKey: PSWDQUVZEXSBST-RNFRBKRXSA-N.
| Molecular formula | C9H15NO4 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | dimethyl (2R,3R)-piperidine-2,3-dicarboxylate |
| InChIKey | PSWDQUVZEXSBST-RNFRBKRXSA-N |
| SMILES | COC(=O)[C@@H]1CCCN[C@H]1C(=O)OC |
Computed by PubChem (NCBI)