CAS 1807882-36-5 appears in our catalog under these names: trans–2–Methylmorpholine–3–carboxylic acid hydrochloride, trans-2-Methylmorpholine-3-carboxylic acid hydrochloride, 98%, 98%, trans-2-Methylmorpholine-3-carboxylic acid hydrochloride, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
(2R,3S)-2-methylmorpholine-3-carboxylic acid;hydrochloride (CAS 1807882-36-5) is a chemical compound with the molecular formula C6H12ClNO3 and a molecular weight of 181.62 g/mol. IUPAC name: (2R,3S)-2-methylmorpholine-3-carboxylic acid;hydrochloride. InChIKey: RHSLKJXCSUYWPS-JBUOLDKXSA-N.
| Molecular formula | C6H12ClNO3 |
|---|---|
| Molecular weight | 181.62 g/mol |
| IUPAC name | (2R,3S)-2-methylmorpholine-3-carboxylic acid;hydrochloride |
| InChIKey | RHSLKJXCSUYWPS-JBUOLDKXSA-N |
| SMILES | C[C@@H]1[C@H](NCCO1)C(=O)O.Cl |
Computed by PubChem (NCBI)