CAS 1808578-40-6 appears in our catalog under these names: (2R,3S)-2-Methylmorpholine-3-carboxylic acid hydrochloride, 98+%, (2R,3S)-2-METHYLMORPHOLINE-3-CARBOXYLIC ACID HCL, 98%. Offered by: AmBeed, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
(2R,3S)-2-methylmorpholine-3-carboxylic acid;hydrochloride (CAS 1808578-40-6) is a chemical compound with the molecular formula C6H12ClNO3 and a molecular weight of 181.62 g/mol. IUPAC name: (2R,3S)-2-methylmorpholine-3-carboxylic acid;hydrochloride. InChIKey: RHSLKJXCSUYWPS-JBUOLDKXSA-N.
| Molecular formula | C6H12ClNO3 |
|---|---|
| Molecular weight | 181.62 g/mol |
| IUPAC name | (2R,3S)-2-methylmorpholine-3-carboxylic acid;hydrochloride |
| InChIKey | RHSLKJXCSUYWPS-JBUOLDKXSA-N |
| SMILES | C[C@@H]1[C@H](NCCO1)C(=O)O.Cl |
Computed by PubChem (NCBI)