CAS 1807896-07-6 appears in our catalog under these names: (1r,3r)-3-(4-bromophenyl)cyclobutan-1-amine hydrochloride, 95%, Trans-3-(4-bromophenyl)cyclobutanamine hydrochloride, 97%, rac-(1r,3r)-3-(4-bromophenyl)cyclobutan-1-amine hydrochloride, trans. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 10g, 0,5g, 50mg.
3-(4-bromophenyl)cyclobutan-1-amine;hydrochloride (CAS 1807896-07-6) is a chemical compound with the molecular formula C10H13BrClN and a molecular weight of 262.57 g/mol. IUPAC name: 3-(4-bromophenyl)cyclobutan-1-amine;hydrochloride. InChIKey: UEKPKVDDKVGUFB-UHFFFAOYSA-N.
| Molecular formula | C10H13BrClN |
|---|---|
| Molecular weight | 262.57 g/mol |
| IUPAC name | 3-(4-bromophenyl)cyclobutan-1-amine;hydrochloride |
| InChIKey | UEKPKVDDKVGUFB-UHFFFAOYSA-N |
| SMILES | C1C(CC1N)C2=CC=C(C=C2)Br.Cl |
Computed by PubChem (NCBI)