Products 1807901-39-8
CAS 1807901-39-8 appears in our catalog under these names: (2R)-2-Amino-1-(2,3-dihydro-1H-isoindol-2-yl)propan-1-one hydrochloride, (2R)-2-amino-1-(2,3-dihydro-1H-isoindol-2-yl)propan-1-one hydrochloride, >95%. Offered by: Biosynth, Chemat. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g.
(2R)-2-amino-1-(1,3-dihydroisoindol-2-yl)propan-1-one;hydrochloride (CAS 1807901-39-8) is a chemical compound with the molecular formula C11H15ClN2O and a molecular weight of 226.70 g/mol. IUPAC name: (2R)-2-amino-1-(1,3-dihydroisoindol-2-yl)propan-1-one;hydrochloride. InChIKey: GEOWNTAEDLVSTJ-DDWIOCJRSA-N.
| Molecular formula | C11H15ClN2O |
|---|---|
| Molecular weight | 226.70 g/mol |
| IUPAC name | (2R)-2-amino-1-(1,3-dihydroisoindol-2-yl)propan-1-one;hydrochloride |
| InChIKey | GEOWNTAEDLVSTJ-DDWIOCJRSA-N |
| SMILES | C[C@H](C(=O)N1CC2=CC=CC=C2C1)N.Cl |
Computed by PubChem (NCBI)