CAS 1807912-18-0 is the registry number for rac-(2R,3R)-2-Phenyloxolane-3-carbohydrazide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2R,3R)-2-phenyloxolane-3-carbohydrazide (CAS 1807912-18-0) is a chemical compound with the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. IUPAC name: (2R,3R)-2-phenyloxolane-3-carbohydrazide. InChIKey: NWKLPUKIUCFNBF-ZJUUUORDSA-N.
| Molecular formula | C11H14N2O2 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | (2R,3R)-2-phenyloxolane-3-carbohydrazide |
| InChIKey | NWKLPUKIUCFNBF-ZJUUUORDSA-N |
| SMILES | C1CO[C@H]([C@@H]1C(=O)NN)C2=CC=CC=C2 |
Computed by PubChem (NCBI)