Products 1807914-31-3
CAS 1807914-31-3 is the registry number for rac-(2R,3R)-2-(1-Ethyl-1H-imidazol-2-yl)oxan-3-amine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2R,3R)-2-(1-ethylimidazol-2-yl)oxan-3-amine;dihydrochloride (CAS 1807914-31-3) is a chemical compound with the molecular formula C10H19Cl2N3O and a molecular weight of 268.18 g/mol. IUPAC name: (2R,3R)-2-(1-ethylimidazol-2-yl)oxan-3-amine;dihydrochloride. InChIKey: KROOWORNSXYWEL-UONRGADFSA-N.
| Molecular formula | C10H19Cl2N3O |
|---|---|
| Molecular weight | 268.18 g/mol |
| IUPAC name | (2R,3R)-2-(1-ethylimidazol-2-yl)oxan-3-amine;dihydrochloride |
| InChIKey | KROOWORNSXYWEL-UONRGADFSA-N |
| SMILES | CCN1C=CN=C1[C@H]2[C@@H](CCCO2)N.Cl.Cl |
Computed by PubChem (NCBI)