CAS 1808654-34-3 is the registry number for (2R,3S)-2-(1,3,5-Trimethyl-1H-pyrazol-4-yl)tetrahydrofuran-3-amine dihydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,3S)-2-(1,3,5-trimethylpyrazol-4-yl)oxolan-3-amine;dihydrochloride (CAS 1808654-34-3) is a chemical compound with the molecular formula C10H19Cl2N3O and a molecular weight of 268.18 g/mol. IUPAC name: (2R,3S)-2-(1,3,5-trimethylpyrazol-4-yl)oxolan-3-amine;dihydrochloride. InChIKey: QYXRFDRTPDRUGO-NKPZAKOOSA-N.
| Molecular formula | C10H19Cl2N3O |
|---|---|
| Molecular weight | 268.18 g/mol |
| IUPAC name | (2R,3S)-2-(1,3,5-trimethylpyrazol-4-yl)oxolan-3-amine;dihydrochloride |
| InChIKey | QYXRFDRTPDRUGO-NKPZAKOOSA-N |
| SMILES | CC1=C(C(=NN1C)C)[C@@H]2[C@H](CCO2)N.Cl.Cl |
Computed by PubChem (NCBI)