CAS 1807916-80-8 is the registry number for ((2R,3S)-2-(1-Ethyl-1H-pyrazol-5-yl)tetrahydrofuran-3-yl)methanamine dihydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methanamine;dihydrochloride (CAS 1807916-80-8) is a chemical compound with the molecular formula C10H19Cl2N3O and a molecular weight of 268.18 g/mol. IUPAC name: [(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methanamine;dihydrochloride. InChIKey: HAKYAOCIWGZSDU-UQZKZZBYSA-N.
| Molecular formula | C10H19Cl2N3O |
|---|---|
| Molecular weight | 268.18 g/mol |
| IUPAC name | [(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methanamine;dihydrochloride |
| InChIKey | HAKYAOCIWGZSDU-UQZKZZBYSA-N |
| SMILES | CCN1C(=CC=N1)[C@H]2[C@@H](CCO2)CN.Cl.Cl |
Computed by PubChem (NCBI)