CAS 1858241-02-7 is the registry number for 1-Methyl-3-(3-methylpiperidin-3-yl)-1h-pyrazol-5-ol dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2-methyl-5-(3-methylpiperidin-3-yl)-1H-pyrazol-3-one;dihydrochloride (CAS 1858241-02-7) is a chemical compound with the molecular formula C10H19Cl2N3O and a molecular weight of 268.18 g/mol. IUPAC name: 2-methyl-5-(3-methylpiperidin-3-yl)-1H-pyrazol-3-one;dihydrochloride. InChIKey: WUYRUINCBUFQMP-UHFFFAOYSA-N.
| Molecular formula | C10H19Cl2N3O |
|---|---|
| Molecular weight | 268.18 g/mol |
| IUPAC name | 2-methyl-5-(3-methylpiperidin-3-yl)-1H-pyrazol-3-one;dihydrochloride |
| InChIKey | WUYRUINCBUFQMP-UHFFFAOYSA-N |
| SMILES | CC1(CCCNC1)C2=CC(=O)N(N2)C.Cl.Cl |
Computed by PubChem (NCBI)