CAS 1807919-94-3 is the registry number for rac-(2R,3R)-2-(1-Phenyl-1H-pyrazol-4-yl)oxolane-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2R,3R)-2-(1-phenylpyrazol-4-yl)oxolane-3-carboxylic acid (CAS 1807919-94-3) is a chemical compound with the molecular formula C14H14N2O3 and a molecular weight of 258.27 g/mol. IUPAC name: (2R,3R)-2-(1-phenylpyrazol-4-yl)oxolane-3-carboxylic acid. InChIKey: ZBXAWODZIJMEBU-OLZOCXBDSA-N.
| Molecular formula | C14H14N2O3 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | (2R,3R)-2-(1-phenylpyrazol-4-yl)oxolane-3-carboxylic acid |
| InChIKey | ZBXAWODZIJMEBU-OLZOCXBDSA-N |
| SMILES | C1CO[C@H]([C@@H]1C(=O)O)C2=CN(N=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)