CAS 1807936-86-2 is the registry number for Methyl (3S,4S)-4-(difluoromethyl)pyrrolidine-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (3S,4S)-4-(difluoromethyl)pyrrolidine-3-carboxylate (CAS 1807936-86-2) is a chemical compound with the molecular formula C7H11F2NO2 and a molecular weight of 179.16 g/mol. IUPAC name: methyl (3S,4S)-4-(difluoromethyl)pyrrolidine-3-carboxylate. InChIKey: KKBIXEUOAPPUHY-RFZPGFLSSA-N.
| Molecular formula | C7H11F2NO2 |
|---|---|
| Molecular weight | 179.16 g/mol |
| IUPAC name | methyl (3S,4S)-4-(difluoromethyl)pyrrolidine-3-carboxylate |
| InChIKey | KKBIXEUOAPPUHY-RFZPGFLSSA-N |
| SMILES | COC(=O)[C@@H]1CNC[C@H]1C(F)F |
Computed by PubChem (NCBI)