CAS 2381478-73-3 is the registry number for (R)-1-(4,4-Difluoro-2-(hydroxymethyl)pyrrolidin-1-yl)ethan-1-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(2R)-4,4-difluoro-2-(hydroxymethyl)pyrrolidin-1-yl]ethanone (CAS 2381478-73-3) is a chemical compound with the molecular formula C7H11F2NO2 and a molecular weight of 179.16 g/mol. IUPAC name: 1-[(2R)-4,4-difluoro-2-(hydroxymethyl)pyrrolidin-1-yl]ethanone. InChIKey: BGAAAJOVIWLSOP-ZCFIWIBFSA-N.
| Molecular formula | C7H11F2NO2 |
|---|---|
| Molecular weight | 179.16 g/mol |
| IUPAC name | 1-[(2R)-4,4-difluoro-2-(hydroxymethyl)pyrrolidin-1-yl]ethanone |
| InChIKey | BGAAAJOVIWLSOP-ZCFIWIBFSA-N |
| SMILES | CC(=O)N1CC(C[C@@H]1CO)(F)F |
Computed by PubChem (NCBI)