CAS 1817631-70-1 is the registry number for (4S,5S)-4-Ethyl-3,3-difluoro-5-(hydroxymethyl)pyrrolidin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4S,5S)-4-ethyl-3,3-difluoro-5-(hydroxymethyl)pyrrolidin-2-one (CAS 1817631-70-1) is a chemical compound with the molecular formula C7H11F2NO2 and a molecular weight of 179.16 g/mol. IUPAC name: (4S,5S)-4-ethyl-3,3-difluoro-5-(hydroxymethyl)pyrrolidin-2-one. InChIKey: XHZQUSYKOMQUMP-CRCLSJGQSA-N.
| Molecular formula | C7H11F2NO2 |
|---|---|
| Molecular weight | 179.16 g/mol |
| IUPAC name | (4S,5S)-4-ethyl-3,3-difluoro-5-(hydroxymethyl)pyrrolidin-2-one |
| InChIKey | XHZQUSYKOMQUMP-CRCLSJGQSA-N |
| SMILES | CC[C@H]1[C@H](NC(=O)C1(F)F)CO |
Computed by PubChem (NCBI)