CAS 1817630-35-5 is the registry number for (3S,4S,5S)-3-Fluoro-4-(2-fluoroethyl)-5-(hydroxymethyl)pyrrolidin-2-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S,4S,5S)-3-fluoro-4-(2-fluoroethyl)-5-(hydroxymethyl)pyrrolidin-2-one (CAS 1817630-35-5) is a chemical compound with the molecular formula C7H11F2NO2 and a molecular weight of 179.16 g/mol. IUPAC name: (3S,4S,5S)-3-fluoro-4-(2-fluoroethyl)-5-(hydroxymethyl)pyrrolidin-2-one. InChIKey: SWMKLEKVCBHFEX-JKUQZMGJSA-N.
| Molecular formula | C7H11F2NO2 |
|---|---|
| Molecular weight | 179.16 g/mol |
| IUPAC name | (3S,4S,5S)-3-fluoro-4-(2-fluoroethyl)-5-(hydroxymethyl)pyrrolidin-2-one |
| InChIKey | SWMKLEKVCBHFEX-JKUQZMGJSA-N |
| SMILES | C(CF)[C@H]1[C@H](NC(=O)[C@H]1F)CO |
Computed by PubChem (NCBI)