CAS 1807939-10-1 appears in our catalog under these names: (2R,5R)-5-Phenylpyrrolidine-2-carboxylic acid hydrochloride, 95%, (2R,5R)-5-Phenylpyrrolidine-2-carboxylic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.
(2R,5R)-5-phenylpyrrolidine-2-carboxylic acid;hydrochloride (CAS 1807939-10-1) is a chemical compound with the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. IUPAC name: (2R,5R)-5-phenylpyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: OPIDXEOJSLEQHK-DHTOPLTISA-N.
| Molecular formula | C11H14ClNO2 |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | (2R,5R)-5-phenylpyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | OPIDXEOJSLEQHK-DHTOPLTISA-N |
| SMILES | C1C[C@@H](N[C@H]1C2=CC=CC=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)