Products 1808157-46-1
CAS 1808157-46-1 is the registry number for [3,3’-Bipyridine]-2,2’-dicarboxylic Acid Hydrate, ≥95%. Offered by: Chemat. Available pack sizes: 100mg.
3-(2-carboxy-3-pyridinyl)pyridine-2-carboxylic acid;hydrate (CAS 1808157-46-1) is a chemical compound with the molecular formula C12H10N2O5 and a molecular weight of 262.22 g/mol. IUPAC name: 3-(2-carboxy-3-pyridinyl)pyridine-2-carboxylic acid;hydrate. InChIKey: YREZHBZWIOHTLG-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O5 |
|---|---|
| Molecular weight | 262.22 g/mol |
| IUPAC name | 3-(2-carboxy-3-pyridinyl)pyridine-2-carboxylic acid;hydrate |
| InChIKey | YREZHBZWIOHTLG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)C(=O)O)C2=C(N=CC=C2)C(=O)O.O |
Computed by PubChem (NCBI)