CAS 1809100-36-4 is the registry number for (Rac)-5-Oxo-pitavastatin. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-7-[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]-3-hydroxy-5-oxohept-6-enoic acid (CAS 1809100-36-4) is a chemical compound with the molecular formula C25H22FNO4 and a molecular weight of 419.4 g/mol. IUPAC name: (E)-7-[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]-3-hydroxy-5-oxohept-6-enoic acid. InChIKey: GSCOCVOFYBEZGB-VAWYXSNFSA-N.
| Molecular formula | C25H22FNO4 |
|---|---|
| Molecular weight | 419.4 g/mol |
| IUPAC name | (E)-7-[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]-3-hydroxy-5-oxohept-6-enoic acid |
| InChIKey | GSCOCVOFYBEZGB-VAWYXSNFSA-N |
| SMILES | C1CC1C2=NC3=CC=CC=C3C(=C2/C=C/C(=O)CC(CC(=O)O)O)C4=CC=C(C=C4)F |
Computed by PubChem (NCBI)