Products 1810069-92-1
CAS 1810069-92-1 appears in our catalog under these names: Benzenepropanoic acid, β-amino-3-cyano-, hydrochloride (1:1), 95%, 95%, 3-Amino-3-(3-cyanophenyl)propanoic acid hydrochloride, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg.
3-amino-3-(3-cyanophenyl)propanoic acid;hydrochloride (CAS 1810069-92-1) is a chemical compound with the molecular formula C10H11ClN2O2 and a molecular weight of 226.66 g/mol. IUPAC name: 3-amino-3-(3-cyanophenyl)propanoic acid;hydrochloride. InChIKey: KDFAFLSYAXYZBB-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2O2 |
|---|---|
| Molecular weight | 226.66 g/mol |
| IUPAC name | 3-amino-3-(3-cyanophenyl)propanoic acid;hydrochloride |
| InChIKey | KDFAFLSYAXYZBB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(CC(=O)O)N)C#N.Cl |
Computed by PubChem (NCBI)