CAS 1810070-07-5 appears in our catalog under these names: Lithium 5-methyl-1,3,4-thiadiazole-2-carboxylate 97%, Lithium 5-methyl-1,3,4-thiadiazole-2-carboxylate, 97%. Offered by: Ambeed, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
Lithium 5-methyl-1,3,4-thiadiazole-2-carboxylate (CAS 1810070-07-5) is a chemical compound with the molecular formula C4H3LiN2O2S and a molecular weight of 150.1 g/mol. IUPAC name: lithium 5-methyl-1,3,4-thiadiazole-2-carboxylate. InChIKey: WWNTUTIEDNLPLZ-UHFFFAOYSA-M.
| Molecular formula | C4H3LiN2O2S |
|---|---|
| Molecular weight | 150.1 g/mol |
| IUPAC name | lithium 5-methyl-1,3,4-thiadiazole-2-carboxylate |
| InChIKey | WWNTUTIEDNLPLZ-UHFFFAOYSA-M |
| SMILES | [Li+].CC1=NN=C(S1)C(=O)[O-] |
Computed by PubChem (NCBI)