CAS 2241129-76-8 is the registry number for Lithium 2-(1,2,5-thiadiazol-3-yl)acetate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Lithium 2-(1,2,5-thiadiazol-3-yl)acetate (CAS 2241129-76-8) is a chemical compound with the molecular formula C4H3LiN2O2S and a molecular weight of 150.1 g/mol. IUPAC name: lithium 2-(1,2,5-thiadiazol-3-yl)acetate. InChIKey: BXHGQQAUMQOZDG-UHFFFAOYSA-M.
| Molecular formula | C4H3LiN2O2S |
|---|---|
| Molecular weight | 150.1 g/mol |
| IUPAC name | lithium 2-(1,2,5-thiadiazol-3-yl)acetate |
| InChIKey | BXHGQQAUMQOZDG-UHFFFAOYSA-M |
| SMILES | [Li+].C1=NSN=C1CC(=O)[O-] |
Computed by PubChem (NCBI)