CAS 2243513-35-9 appears in our catalog under these names: Lithium 2-(1,3,4-thiadiazol-2-yl)acetate, 95%, Lithium 2-(1,3,4-thiadiazol-2-yl)acetate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Lithium 2-(1,3,4-thiadiazol-2-yl)acetate (CAS 2243513-35-9) is a chemical compound with the molecular formula C4H3LiN2O2S and a molecular weight of 150.1 g/mol. IUPAC name: lithium 2-(1,3,4-thiadiazol-2-yl)acetate. InChIKey: LTJNBKHCERKKBB-UHFFFAOYSA-M.
| Molecular formula | C4H3LiN2O2S |
|---|---|
| Molecular weight | 150.1 g/mol |
| IUPAC name | lithium 2-(1,3,4-thiadiazol-2-yl)acetate |
| InChIKey | LTJNBKHCERKKBB-UHFFFAOYSA-M |
| SMILES | [Li+].C1=NN=C(S1)CC(=O)[O-] |
Computed by PubChem (NCBI)