Products 2172528-18-4
CAS 2172528-18-4 is the registry number for Lithium 3-methyl-1,2,4-thiadiazole-5-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Lithium 3-methyl-1,2,4-thiadiazole-5-carboxylate (CAS 2172528-18-4) is a chemical compound with the molecular formula C4H3LiN2O2S and a molecular weight of 150.1 g/mol. IUPAC name: lithium 3-methyl-1,2,4-thiadiazole-5-carboxylate. InChIKey: DQYNAXDIPZGDOZ-UHFFFAOYSA-M.
| Molecular formula | C4H3LiN2O2S |
|---|---|
| Molecular weight | 150.1 g/mol |
| IUPAC name | lithium 3-methyl-1,2,4-thiadiazole-5-carboxylate |
| InChIKey | DQYNAXDIPZGDOZ-UHFFFAOYSA-M |
| SMILES | [Li+].CC1=NSC(=N1)C(=O)[O-] |
Computed by PubChem (NCBI)