CAS 1810074-64-6 appears in our catalog under these names: (S)-1-(4-Bromo-3-chlorophenyl)ethanamine hydrochloride, 95%, (S)–1–(4–Bromo–3–chlorophenyl)ethanamine hydrochloride, (S)-1-(4-bromo-3-chlorophenyl)ethanamine hydrochloride, (S)-1-(4-Bromo-3-chlorophenyl)ethanamine hydrochloride, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 0,5g, 50mg.
(1S)-1-(4-bromo-3-chlorophenyl)ethanamine;hydrochloride (CAS 1810074-64-6) is a chemical compound with the molecular formula C8H10BrCl2N and a molecular weight of 270.98 g/mol. IUPAC name: (1S)-1-(4-bromo-3-chlorophenyl)ethanamine;hydrochloride. InChIKey: JOIWHZVZBBUSRA-JEDNCBNOSA-N.
| Molecular formula | C8H10BrCl2N |
|---|---|
| Molecular weight | 270.98 g/mol |
| IUPAC name | (1S)-1-(4-bromo-3-chlorophenyl)ethanamine;hydrochloride |
| InChIKey | JOIWHZVZBBUSRA-JEDNCBNOSA-N |
| SMILES | C[C@@H](C1=CC(=C(C=C1)Br)Cl)N.Cl |
Computed by PubChem (NCBI)