CAS 943152-94-1 appears in our catalog under these names: 1-(4-Bromo-2-chlorophenyl)ethan-1-amine hydrochloride, 97%, 1-(4-Bromo-2-chlorophenyl)ethan-1-amine hydrochloride, 97%, 97%. Offered by: AmBeed, Fluorochem, Chemat. Available pack sizes: 10g, 100mg, 250mg, 500mg, 1g, 5g.
1-(4-bromo-2-chlorophenyl)ethanamine;hydrochloride (CAS 943152-94-1) is a chemical compound with the molecular formula C8H10BrCl2N and a molecular weight of 270.98 g/mol. IUPAC name: 1-(4-bromo-2-chlorophenyl)ethanamine;hydrochloride. InChIKey: CRKRMNPAHHHNHR-UHFFFAOYSA-N.
| Molecular formula | C8H10BrCl2N |
|---|---|
| Molecular weight | 270.98 g/mol |
| IUPAC name | 1-(4-bromo-2-chlorophenyl)ethanamine;hydrochloride |
| InChIKey | CRKRMNPAHHHNHR-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=C(C=C1)Br)Cl)N.Cl |
Computed by PubChem (NCBI)