Products 2866353-84-4
CAS 2866353-84-4 is the registry number for 2-(2-bromo-6-chlorophenyl)ethan-1-amine hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-(2-bromo-6-chlorophenyl)ethanamine;hydrochloride (CAS 2866353-84-4) is a chemical compound with the molecular formula C8H10BrCl2N and a molecular weight of 270.98 g/mol. IUPAC name: 2-(2-bromo-6-chlorophenyl)ethanamine;hydrochloride. InChIKey: BHAYUMTYVYAVGB-UHFFFAOYSA-N.
| Molecular formula | C8H10BrCl2N |
|---|---|
| Molecular weight | 270.98 g/mol |
| IUPAC name | 2-(2-bromo-6-chlorophenyl)ethanamine;hydrochloride |
| InChIKey | BHAYUMTYVYAVGB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)CCN)Cl.Cl |
Computed by PubChem (NCBI)