Products 2503202-23-9
CAS 2503202-23-9 is the registry number for [(5-Bromo-2-chlorophenyl)methyl](methyl)amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
1-(5-bromo-2-chlorophenyl)-N-methylmethanamine;hydrochloride (CAS 2503202-23-9) is a chemical compound with the molecular formula C8H10BrCl2N and a molecular weight of 270.98 g/mol. IUPAC name: 1-(5-bromo-2-chlorophenyl)-N-methylmethanamine;hydrochloride. InChIKey: QBENBXPUAZYCNG-UHFFFAOYSA-N.
| Molecular formula | C8H10BrCl2N |
|---|---|
| Molecular weight | 270.98 g/mol |
| IUPAC name | 1-(5-bromo-2-chlorophenyl)-N-methylmethanamine;hydrochloride |
| InChIKey | QBENBXPUAZYCNG-UHFFFAOYSA-N |
| SMILES | CNCC1=C(C=CC(=C1)Br)Cl.Cl |
Computed by PubChem (NCBI)