CAS 181140-34-1 appears in our catalog under these names: (R)-2-Oxiranylmethylisoindole-1,3-dione, Rivaroxaban Impurity 90, R-N-Glycidyl Phthalimide, N-(R)-Glycidyl Phthalimide, (R)–(–)–N–(2,3–Epoxypropyl)phthalimide. Offered by: Chemat, Chemat Brand, TRC, GLPBio, Biosynth. Available pack sizes: 1g, on request, 5g, 100g, 25g, 50g, 10g.
2-[[(2R)-oxiran-2-yl]methyl]isoindole-1,3-dione (CAS 181140-34-1) is a chemical compound with the molecular formula C11H9NO3 and a molecular weight of 203.19 g/mol. IUPAC name: 2-[[(2R)-oxiran-2-yl]methyl]isoindole-1,3-dione. InChIKey: DUILGEYLVHGSEE-SSDOTTSWSA-N.
| Molecular formula | C11H9NO3 |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | 2-[[(2R)-oxiran-2-yl]methyl]isoindole-1,3-dione |
| InChIKey | DUILGEYLVHGSEE-SSDOTTSWSA-N |
| SMILES | C1[C@H](O1)CN2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)