CAS 181285-06-3 is the registry number for Ethyl 3-amino-5-methoxy-1-benzothiophene-2-carboxylate, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Ethyl 3-amino-5-methoxy-1-benzothiophene-2-carboxylate (CAS 181285-06-3) is a chemical compound with the molecular formula C12H13NO3S and a molecular weight of 251.30 g/mol. IUPAC name: ethyl 3-amino-5-methoxy-1-benzothiophene-2-carboxylate. InChIKey: UQZIQYCFDPABDF-UHFFFAOYSA-N.
| Molecular formula | C12H13NO3S |
|---|---|
| Molecular weight | 251.30 g/mol |
| IUPAC name | ethyl 3-amino-5-methoxy-1-benzothiophene-2-carboxylate |
| InChIKey | UQZIQYCFDPABDF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=C(S1)C=CC(=C2)OC)N |
Computed by PubChem (NCBI)