Products 378196-87-3

CAS 378196-87-3 is the registry number for 2-Amino-4-(5-methyl-furan-2-yl)-thiophene-3-carboxylic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 2-amino-4-(5-methylfuran-2-yl)thiophene-3-carboxylate (CAS 378196-87-3) is a chemical compound with the molecular formula C12H13NO3S and a molecular weight of 251.30 g/mol. IUPAC name: ethyl 2-amino-4-(5-methylfuran-2-yl)thiophene-3-carboxylate. InChIKey: BGFHMNNBBDLFDU-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13NO3S
Molecular weight251.30 g/mol
IUPAC nameethyl 2-amino-4-(5-methylfuran-2-yl)thiophene-3-carboxylate
InChIKeyBGFHMNNBBDLFDU-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(SC=C1C2=CC=C(O2)C)N

Computed by PubChem (NCBI)