Products 63674-53-3

CAS 63674-53-3 is the registry number for 1-[4-(Methylthio)phenyl]-5-oxopyrrolidine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 5g, 10g, 250mg, 1g.

Structural formula: {0} (CAS {1})

1-(4-methylsulfanylphenyl)-5-oxopyrrolidine-3-carboxylic acid (CAS 63674-53-3) is a chemical compound with the molecular formula C12H13NO3S and a molecular weight of 251.30 g/mol. IUPAC name: 1-(4-methylsulfanylphenyl)-5-oxopyrrolidine-3-carboxylic acid. InChIKey: AJNDJEPFDFCOIF-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13NO3S
Molecular weight251.30 g/mol
IUPAC name1-(4-methylsulfanylphenyl)-5-oxopyrrolidine-3-carboxylic acid
InChIKeyAJNDJEPFDFCOIF-UHFFFAOYSA-N
SMILESCSC1=CC=C(C=C1)N2CC(CC2=O)C(=O)O

Computed by PubChem (NCBI)