CAS 288569-60-8 appears in our catalog under these names: (1-Cyanocyclopropyl)methyl 4-methylbenzenesulfonate, 95%, (1–Cyanocyclopropyl)methyl 4–methylbenzenesulfonate, (1-Cyanocyclopropyl)methyl 4-methylbenzenesulfonate, 97%, 97%, 1-[[[(4-METHYLPHENYL)SULFONYL]OXY]METHYL]CYCLOPROPANECARBONITRILE, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(1-cyanocyclopropyl)methyl 4-methylbenzenesulfonate (CAS 288569-60-8) is a chemical compound with the molecular formula C12H13NO3S and a molecular weight of 251.30 g/mol. IUPAC name: (1-cyanocyclopropyl)methyl 4-methylbenzenesulfonate. InChIKey: ZIGSROJSFJRBBT-UHFFFAOYSA-N.
| Molecular formula | C12H13NO3S |
|---|---|
| Molecular weight | 251.30 g/mol |
| IUPAC name | (1-cyanocyclopropyl)methyl 4-methylbenzenesulfonate |
| InChIKey | ZIGSROJSFJRBBT-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC2(CC2)C#N |
Computed by PubChem (NCBI)