CAS 181289-45-2 is the registry number for Pregabalin Impurity 46. Offered by: Chemat Brand. Available pack sizes: on request.
(3S)-5-methyl-3-(nitromethyl)hexanoic acid (CAS 181289-45-2) is a chemical compound with the molecular formula C8H15NO4 and a molecular weight of 189.21 g/mol. IUPAC name: (3S)-5-methyl-3-(nitromethyl)hexanoic acid. InChIKey: DTIRCYURNGJGSY-ZETCQYMHSA-N.
| Molecular formula | C8H15NO4 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | (3S)-5-methyl-3-(nitromethyl)hexanoic acid |
| InChIKey | DTIRCYURNGJGSY-ZETCQYMHSA-N |
| SMILES | CC(C)C[C@@H](CC(=O)O)C[N+](=O)[O-] |
Computed by PubChem (NCBI)