CAS 18144-43-9 appears in our catalog under these names: Isopropyl 4-aminobenzoate, 98%, Isopropyl 4-Aminobenzoate, >95% (HPLC), Isopropyl 4-Aminobenzoate, Isopropyl 4–Aminobenzoate, Isopropyl 4-aminobenzoate, 98% . Offered by: Combi-blocks, TRC, Mikromol, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: 1g, 25g, 5g, 25mg, 100g, 0,1kg, 0,25kg, 0,5kg.
Propan-2-yl 4-aminobenzoate (CAS 18144-43-9) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: propan-2-yl 4-aminobenzoate. InChIKey: JWCPZKNBPMSYND-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | propan-2-yl 4-aminobenzoate |
| InChIKey | JWCPZKNBPMSYND-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C1=CC=C(C=C1)N |
Computed by PubChem (NCBI)